C11H15N3O6 — CID 25112902
5-methyl-1-[(2R,3S,4S,5S)-3,4,5-trihydroxy-1-methyl-6-oxopiperidin-2-yl]pyrimidine-2,4-dione (PubChem CID 25112902) has the molecular formula C11H15N3O6 and a molecular weight of 285.26 g/mol. Its IUPAC name is 5-methyl-1-[(2R,3S,4S,5S)-3,4,5-trihydroxy-1-methyl-6-oxopiperidin-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-[(2R,3S,4S,5S)-3,4,5-trihydroxy-1-methyl-6-oxopiperidin-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 25112902 |
| Molecular Formula | C11H15N3O6 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 5-methyl-1-[(2R,3S,4S,5S)-3,4,5-trihydroxy-1-methyl-6-oxopiperidin-2-yl]pyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2[C@H](O)[C@H](O)[C@H](O)C(=O)N2C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15N3O6/c1-4-3-14(11(20)12-8(4)18)9-6(16)5(15)7(17)10(19)13(9)2/h3,5-7,9,15-17H,1-2H3,(H,12,18,20)/t5-,6+,7-,9+/m0/s1 |
| InChIKey | JLMIOYOYACUIBW-VOQBNFLRSA-N |
| XLogP | -3.10 |
| TPSA | 135.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |