C9H13N3O3 — CID 138975124
1-[(4R)-4-hydroxypyrrolidin-3-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 138975124) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 1-[(4R)-4-hydroxypyrrolidin-3-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(4R)-4-hydroxypyrrolidin-3-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 138975124 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 1-[(4R)-4-hydroxypyrrolidin-3-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(C2CNC[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H13N3O3/c1-5-4-12(9(15)11-8(5)14)6-2-10-3-7(6)13/h4,6-7,10,13H,2-3H2,1H3,(H,11,14,15)/t6?,7-/m1/s1 |
| InChIKey | OECBKIWKIALCNH-COBSHVIPSA-N |
| XLogP | -1.65 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |