C10H15N3O3 — CID 51050699
1-[(3S,5R)-5-hydroxypiperidin-3-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 51050699) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 1-[(3S,5R)-5-hydroxypiperidin-3-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(3S,5R)-5-hydroxypiperidin-3-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 51050699 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 1-[(3S,5R)-5-hydroxypiperidin-3-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2CNC[C@H](O)C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N3O3/c1-6-5-13(10(16)12-9(6)15)7-2-8(14)4-11-3-7/h5,7-8,11,14H,2-4H2,1H3,(H,12,15,16)/t7-,8+/m0/s1 |
| InChIKey | IXDWETHWMNXWIN-JGVFFNPUSA-N |
| XLogP | -1.26 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |