C10H12N2O5S — CID 100925330
1-[(2R,4S,5R)-4,5-dihydroxy-6-sulfanylideneoxan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 100925330) has the molecular formula C10H12N2O5S and a molecular weight of 272.28 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4,5-dihydroxy-6-sulfanylideneoxan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4,5-dihydroxy-6-sulfanylideneoxan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 100925330 |
| Molecular Formula | C10H12N2O5S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 1-[(2R,4S,5R)-4,5-dihydroxy-6-sulfanylideneoxan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](O)C(=S)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H12N2O5S/c1-4-3-12(10(16)11-8(4)15)6-2-5(13)7(14)9(18)17-6/h3,5-7,13-14H,2H2,1H3,(H,11,15,16)/t5-,6+,7+/m0/s1 |
| InChIKey | WGAOXZRQKDLZDS-RRKCRQDMSA-N |
| XLogP | -1.19 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|