C10H14N2O3 — CID 10443092
1-[(1S,3R)-3-hydroxycyclopentyl]-5-methylpyrimidine-2,4-dione (PubChem CID 10443092) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 1-[(1S,3R)-3-hydroxycyclopentyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(1S,3R)-3-hydroxycyclopentyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10443092 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 1-[(1S,3R)-3-hydroxycyclopentyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2CC[C@@H](O)C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H14N2O3/c1-6-5-12(10(15)11-9(6)14)7-2-3-8(13)4-7/h5,7-8,13H,2-4H2,1H3,(H,11,14,15)/t7-,8+/m0/s1 |
| InChIKey | KIJFCOLLMXGQKU-JGVFFNPUSA-N |
| XLogP | -0.07 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |