C11H17N3O4 — CID 110153692
1-[(1S,2S,3S,4R)-4-(aminomethyl)-2,3-dihydroxycyclopentyl]-5-methylpyrimidine-2,4-dione (PubChem CID 110153692) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is 1-[(1S,2S,3S,4R)-4-(aminomethyl)-2,3-dihydroxycyclopentyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(1S,2S,3S,4R)-4-(aminomethyl)-2,3-dihydroxycyclopentyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 110153692 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 1-[(1S,2S,3S,4R)-4-(aminomethyl)-2,3-dihydroxycyclopentyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](CN)[C@H](O)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H17N3O4/c1-5-4-14(11(18)13-10(5)17)7-2-6(3-12)8(15)9(7)16/h4,6-9,15-16H,2-3,12H2,1H3,(H,13,17,18)/t6-,7+,8+,9+/m1/s1 |
| InChIKey | DCNSVOCUYGRSQU-XGEHTFHBSA-N |
| XLogP | -1.91 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |