C11H15BrN2O3 — CID 125478927
1-(6-bromohexanoyl)-5-methylpyrimidine-2,4-dione (PubChem CID 125478927) has the molecular formula C11H15BrN2O3 and a molecular weight of 303.16 g/mol. Its IUPAC name is 1-(6-bromohexanoyl)-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-(6-bromohexanoyl)-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 125478927 |
| Molecular Formula | C11H15BrN2O3 |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 1-(6-bromohexanoyl)-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(C(=O)CCCCCBr)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15BrN2O3/c1-8-7-14(11(17)13-10(8)16)9(15)5-3-2-4-6-12/h7H,2-6H2,1H3,(H,13,16,17) |
| InChIKey | SYDIDCCKCPFPQR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|