C9H11BrN2O3 — CID 125478537
1-(5-bromopentanoyl)pyrimidine-2,4-dione (PubChem CID 125478537) has the molecular formula C9H11BrN2O3 and a molecular weight of 275.10 g/mol. Its IUPAC name is 1-(5-bromopentanoyl)pyrimidine-2,4-dione.
| Compound Name | 1-(5-bromopentanoyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 125478537 |
| Molecular Formula | C9H11BrN2O3 |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 1-(5-bromopentanoyl)pyrimidine-2,4-dione |
| SMILES | O=C(CCCCBr)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C9H11BrN2O3/c10-5-2-1-3-8(14)12-6-4-7(13)11-9(12)15/h4,6H,1-3,5H2,(H,11,13,15) |
| InChIKey | JZLIFFSWMZDBOY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|