C11H17N3O5 — CID 118606674
1-[3-[2-(2-aminoethoxy)ethoxy]propanoyl]pyrimidine-2,4-dione (PubChem CID 118606674) has the molecular formula C11H17N3O5 and a molecular weight of 271.27 g/mol. Its IUPAC name is 1-[3-[2-(2-aminoethoxy)ethoxy]propanoyl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-[2-(2-aminoethoxy)ethoxy]propanoyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118606674 |
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 1-[3-[2-(2-aminoethoxy)ethoxy]propanoyl]pyrimidine-2,4-dione |
| SMILES | NCCOCCOCCC(=O)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C11H17N3O5/c12-3-6-19-8-7-18-5-2-10(16)14-4-1-9(15)13-11(14)17/h1,4H,2-3,5-8,12H2,(H,13,15,17) |
| InChIKey | SETVHACQFMEVDZ-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|