C6H5FN2O2 — CID 67743513
1-(1-fluoroethenyl)pyrimidine-2,4-dione (PubChem CID 67743513) has the molecular formula C6H5FN2O2 and a molecular weight of 156.12 g/mol. Its IUPAC name is 1-(1-fluoroethenyl)pyrimidine-2,4-dione.
| Compound Name | 1-(1-fluoroethenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67743513 |
| Molecular Formula | C6H5FN2O2 |
| Molecular Weight | 156.12 g/mol |
| Exact Mass | 156.03 |
| IUPAC Name | 1-(1-fluoroethenyl)pyrimidine-2,4-dione |
| SMILES | C=C(F)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C6H5FN2O2/c1-4(7)9-3-2-5(10)8-6(9)11/h2-3H,1H2,(H,8,10,11) |
| InChIKey | AKAPYEYHTOJWJJ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.12 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |