2,4-dioxopyrimidine-1-carboxylic acid;zinc

C5H4N2O4Zn — CID 174838815

IUPAC2,4-dioxopyrimidine-1-carboxylic acid;zinc
SMILESO=C(O)n1ccc(=O)[nH]c1=O.[Zn]
InChIInChI=1S/C5H4N2O4.Zn/c8-3-1-2-7(5(10)11)4(9)6-3;/h1-2H,(H,10,11)(H,6,8,9);
InChIKeyGEXPOWLRWHHEFT-UHFFFAOYSA-N
MW221.49 g/mol
LogP-0.94
Rot. Bonds

About 2,4-dioxopyrimidine-1-carboxylic acid;zinc

2,4-dioxopyrimidine-1-carboxylic acid;zinc (PubChem CID 174838815) has the molecular formula C5H4N2O4Zn and a molecular weight of 221.49 g/mol. Its IUPAC name is 2,4-dioxopyrimidine-1-carboxylic acid;zinc.

Molecular Properties

Compound Name2,4-dioxopyrimidine-1-carboxylic acid;zinc
PubChem CID174838815
Molecular FormulaC5H4N2O4Zn
Molecular Weight221.49 g/mol
Exact Mass219.95
IUPAC Name2,4-dioxopyrimidine-1-carboxylic acid;zinc
SMILESO=C(O)n1ccc(=O)[nH]c1=O.[Zn]
InChIInChI=1S/C5H4N2O4.Zn/c8-3-1-2-7(5(10)11)4(9)6-3;/h1-2H,(H,10,11)(H,6,8,9);
InChIKeyGEXPOWLRWHHEFT-UHFFFAOYSA-N
XLogP-0.94
TPSA92.16 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.49
LogP ≤ 5-0.94
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 2,4-dioxopyrimidine-1-carboxylic acid;zinc with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dioxopyrimidine-1-carboxylic acid;zinc?
The IUPAC name of 2,4-dioxopyrimidine-1-carboxylic acid;zinc (CID 174838815) is 2,4-dioxopyrimidine-1-carboxylic acid;zinc.
What is the SMILES notation for 2,4-dioxopyrimidine-1-carboxylic acid;zinc?
The canonical SMILES for 2,4-dioxopyrimidine-1-carboxylic acid;zinc is O=C(O)n1ccc(=O)[nH]c1=O.[Zn].
What is the InChIKey of 2,4-dioxopyrimidine-1-carboxylic acid;zinc?
The InChIKey is GEXPOWLRWHHEFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O4.Zn/c8-3-1-2-7(5(10)11)4(9)6-3;/h1-2H,(H,10,11)(H,6,8,9);.
What are the key properties of 2,4-dioxopyrimidine-1-carboxylic acid;zinc?
2,4-dioxopyrimidine-1-carboxylic acid;zinc has a molecular weight of 221.49 g/mol, XLogP of -0.94, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dioxopyrimidine-1-carboxylic acid;zinc is sourced from PubChem (CID 174838815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).