C5H4N2O4Zn — CID 174838815
2,4-dioxopyrimidine-1-carboxylic acid;zinc (PubChem CID 174838815) has the molecular formula C5H4N2O4Zn and a molecular weight of 221.49 g/mol. Its IUPAC name is 2,4-dioxopyrimidine-1-carboxylic acid;zinc.
| Compound Name | 2,4-dioxopyrimidine-1-carboxylic acid;zinc |
|---|---|
| PubChem CID | 174838815 |
| Molecular Formula | C5H4N2O4Zn |
| Molecular Weight | 221.49 g/mol |
| Exact Mass | 219.95 |
| IUPAC Name | 2,4-dioxopyrimidine-1-carboxylic acid;zinc |
| SMILES | O=C(O)n1ccc(=O)[nH]c1=O.[Zn] |
| InChI | InChI=1S/C5H4N2O4.Zn/c8-3-1-2-7(5(10)11)4(9)6-3;/h1-2H,(H,10,11)(H,6,8,9); |
| InChIKey | GEXPOWLRWHHEFT-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.49 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|