About (2,4-dioxopyrimidin-1-yl) acetate
(2,4-dioxopyrimidin-1-yl) acetate (PubChem CID 57007226) has the molecular formula C6H6N2O4
and a molecular weight of 170.12 g/mol. Its IUPAC name is (2,4-dioxopyrimidin-1-yl) acetate.
Molecular Properties
| Compound Name | (2,4-dioxopyrimidin-1-yl) acetate |
| PubChem CID | 57007226 |
| Molecular Formula | C6H6N2O4 |
| Molecular Weight | 170.12 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | (2,4-dioxopyrimidin-1-yl) acetate |
| SMILES | CC(=O)On1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C6H6N2O4/c1-4(9)12-8-3-2-5(10)7-6(8)11/h2-3H,1H3,(H,7,10,11) |
| InChIKey | XKMNQOMEPQTIQN-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.12 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2,4-dioxopyrimidin-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dioxopyrimidin-1-yl) acetate?
The IUPAC name of (2,4-dioxopyrimidin-1-yl) acetate (CID 57007226) is (2,4-dioxopyrimidin-1-yl) acetate.
What is the SMILES notation for (2,4-dioxopyrimidin-1-yl) acetate?
The canonical SMILES for (2,4-dioxopyrimidin-1-yl) acetate is CC(=O)On1ccc(=O)[nH]c1=O.
What is the InChIKey of (2,4-dioxopyrimidin-1-yl) acetate?
The InChIKey is XKMNQOMEPQTIQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O4/c1-4(9)12-8-3-2-5(10)7-6(8)11/h2-3H,1H3,(H,7,10,11).
What are the key properties of (2,4-dioxopyrimidin-1-yl) acetate?
(2,4-dioxopyrimidin-1-yl) acetate has a molecular weight of 170.12 g/mol, XLogP of -1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dioxopyrimidin-1-yl) acetate is sourced from PubChem (CID 57007226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).