About N-(2,4-dioxopyrimidin-1-yl)acetamide
N-(2,4-dioxopyrimidin-1-yl)acetamide (PubChem CID 11819433) has the molecular formula C6H7N3O3
and a molecular weight of 169.14 g/mol. Its IUPAC name is N-(2,4-dioxopyrimidin-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(2,4-dioxopyrimidin-1-yl)acetamide |
| PubChem CID | 11819433 |
| Molecular Formula | C6H7N3O3 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | N-(2,4-dioxopyrimidin-1-yl)acetamide |
| SMILES | CC(=O)Nn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C6H7N3O3/c1-4(10)8-9-3-2-5(11)7-6(9)12/h2-3H,1H3,(H,8,10)(H,7,11,12) |
| InChIKey | PEVKNDZTCMHYFG-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2,4-dioxopyrimidin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-dioxopyrimidin-1-yl)acetamide?
The IUPAC name of N-(2,4-dioxopyrimidin-1-yl)acetamide (CID 11819433) is N-(2,4-dioxopyrimidin-1-yl)acetamide.
What is the SMILES notation for N-(2,4-dioxopyrimidin-1-yl)acetamide?
The canonical SMILES for N-(2,4-dioxopyrimidin-1-yl)acetamide is CC(=O)Nn1ccc(=O)[nH]c1=O.
What is the InChIKey of N-(2,4-dioxopyrimidin-1-yl)acetamide?
The InChIKey is PEVKNDZTCMHYFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O3/c1-4(10)8-9-3-2-5(11)7-6(9)12/h2-3H,1H3,(H,8,10)(H,7,11,12).
What are the key properties of N-(2,4-dioxopyrimidin-1-yl)acetamide?
N-(2,4-dioxopyrimidin-1-yl)acetamide has a molecular weight of 169.14 g/mol, XLogP of -1.37, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-dioxopyrimidin-1-yl)acetamide is sourced from PubChem (CID 11819433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).