C7H12N2O2 — CID 91098384
ethane;1-methylpyrimidine-2,4-dione (PubChem CID 91098384) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is ethane;1-methylpyrimidine-2,4-dione.
| Compound Name | ethane;1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91098384 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | ethane;1-methylpyrimidine-2,4-dione |
| SMILES | CC.Cn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C5H6N2O2.C2H6/c1-7-3-2-4(8)6-5(7)9;1-2/h2-3H,1H3,(H,6,8,9);1-2H3 |
| InChIKey | YZZZFVDBOMDTGD-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |