C7H13N2O2P — CID 175119511
ethylphosphane;1-methylpyrimidine-2,4-dione (PubChem CID 175119511) has the molecular formula C7H13N2O2P and a molecular weight of 188.17 g/mol. Its IUPAC name is ethylphosphane;1-methylpyrimidine-2,4-dione.
| Compound Name | ethylphosphane;1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 175119511 |
| Molecular Formula | C7H13N2O2P |
| Molecular Weight | 188.17 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | ethylphosphane;1-methylpyrimidine-2,4-dione |
| SMILES | CCP.Cn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C5H6N2O2.C2H7P/c1-7-3-2-4(8)6-5(7)9;1-2-3/h2-3H,1H3,(H,6,8,9);2-3H2,1H3 |
| InChIKey | PBKJEQKUDIEMJG-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.17 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|