C10H18N2O4 — CID 145045789
(2S)-2-methoxybutan-1-ol;1-methylpyrimidine-2,4-dione (PubChem CID 145045789) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is (2S)-2-methoxybutan-1-ol;1-methylpyrimidine-2,4-dione.
| Compound Name | (2S)-2-methoxybutan-1-ol;1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 145045789 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (2S)-2-methoxybutan-1-ol;1-methylpyrimidine-2,4-dione |
| SMILES | CC[C@@H](CO)OC.Cn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C5H6N2O2.C5H12O2/c1-7-3-2-4(8)6-5(7)9;1-3-5(4-6)7-2/h2-3H,1H3,(H,6,8,9);5-6H,3-4H2,1-2H3/t;5-/m.0/s1 |
| InChIKey | XWBDPGGEEKRPKZ-ZSCHJXSPSA-N |
| XLogP | -0.52 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |