About (2,4-dioxopyrimidin-1-yl) propanoate
(2,4-dioxopyrimidin-1-yl) propanoate (PubChem CID 174912968) has the molecular formula C7H8N2O4
and a molecular weight of 184.15 g/mol. Its IUPAC name is (2,4-dioxopyrimidin-1-yl) propanoate.
Molecular Properties
| Compound Name | (2,4-dioxopyrimidin-1-yl) propanoate |
| PubChem CID | 174912968 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | (2,4-dioxopyrimidin-1-yl) propanoate |
| SMILES | CCC(=O)On1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C7H8N2O4/c1-2-6(11)13-9-4-3-5(10)8-7(9)12/h3-4H,2H2,1H3,(H,8,10,12) |
| InChIKey | OSWQRFKPLPNTCU-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2,4-dioxopyrimidin-1-yl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dioxopyrimidin-1-yl) propanoate?
The IUPAC name of (2,4-dioxopyrimidin-1-yl) propanoate (CID 174912968) is (2,4-dioxopyrimidin-1-yl) propanoate.
What is the SMILES notation for (2,4-dioxopyrimidin-1-yl) propanoate?
The canonical SMILES for (2,4-dioxopyrimidin-1-yl) propanoate is CCC(=O)On1ccc(=O)[nH]c1=O.
What is the InChIKey of (2,4-dioxopyrimidin-1-yl) propanoate?
The InChIKey is OSWQRFKPLPNTCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4/c1-2-6(11)13-9-4-3-5(10)8-7(9)12/h3-4H,2H2,1H3,(H,8,10,12).
What are the key properties of (2,4-dioxopyrimidin-1-yl) propanoate?
(2,4-dioxopyrimidin-1-yl) propanoate has a molecular weight of 184.15 g/mol, XLogP of -1.10, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dioxopyrimidin-1-yl) propanoate is sourced from PubChem (CID 174912968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).