C10H15N3O4 — CID 57302297
(2,4-dioxopyrimidin-1-yl) (2S)-2-amino-4-methylpentanoate (PubChem CID 57302297) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is (2,4-dioxopyrimidin-1-yl) (2S)-2-amino-4-methylpentanoate.
| Compound Name | (2,4-dioxopyrimidin-1-yl) (2S)-2-amino-4-methylpentanoate |
|---|---|
| PubChem CID | 57302297 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (2,4-dioxopyrimidin-1-yl) (2S)-2-amino-4-methylpentanoate |
| SMILES | CC(C)C[C@H](N)C(=O)On1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N3O4/c1-6(2)5-7(11)9(15)17-13-4-3-8(14)12-10(13)16/h3-4,6-7H,5,11H2,1-2H3,(H,12,14,16)/t7-/m0/s1 |
| InChIKey | DVINGHMJHBJFAH-ZETCQYMHSA-N |
| XLogP | -1.13 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |