About (2,4-dioxopyrimidin-1-yl) (2S)-2-amino-4-methylpentanoate
(2,4-dioxopyrimidin-1-yl) (2S)-2-amino-4-methylpentanoate (PubChem CID 57302297) has the molecular formula C10H15N3O4
and a molecular weight of 241.25 g/mol. Its IUPAC name is (2,4-dioxopyrimidin-1-yl) (2S)-2-amino-4-methylpentanoate.
Molecular Properties
| Compound Name | (2,4-dioxopyrimidin-1-yl) (2S)-2-amino-4-methylpentanoate |
| PubChem CID | 57302297 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (2,4-dioxopyrimidin-1-yl) (2S)-2-amino-4-methylpentanoate |
| SMILES | CC(C)C[C@H](N)C(=O)On1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N3O4/c1-6(2)5-7(11)9(15)17-13-4-3-8(14)12-10(13)16/h3-4,6-7H,5,11H2,1-2H3,(H,12,14,16)/t7-/m0/s1 |
| InChIKey | DVINGHMJHBJFAH-ZETCQYMHSA-N |
| XLogP | -1.13 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2,4-dioxopyrimidin-1-yl) (2S)-2-amino-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dioxopyrimidin-1-yl) (2S)-2-amino-4-methylpentanoate?
The IUPAC name of (2,4-dioxopyrimidin-1-yl) (2S)-2-amino-4-methylpentanoate (CID 57302297) is (2,4-dioxopyrimidin-1-yl) (2S)-2-amino-4-methylpentanoate.
What is the SMILES notation for (2,4-dioxopyrimidin-1-yl) (2S)-2-amino-4-methylpentanoate?
The canonical SMILES for (2,4-dioxopyrimidin-1-yl) (2S)-2-amino-4-methylpentanoate is CC(C)C[C@H](N)C(=O)On1ccc(=O)[nH]c1=O.
What is the InChIKey of (2,4-dioxopyrimidin-1-yl) (2S)-2-amino-4-methylpentanoate?
The InChIKey is DVINGHMJHBJFAH-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H15N3O4/c1-6(2)5-7(11)9(15)17-13-4-3-8(14)12-10(13)16/h3-4,6-7H,5,11H2,1-2H3,(H,12,14,16)/t7-/m0/s1.
What are the key properties of (2,4-dioxopyrimidin-1-yl) (2S)-2-amino-4-methylpentanoate?
(2,4-dioxopyrimidin-1-yl) (2S)-2-amino-4-methylpentanoate has a molecular weight of 241.25 g/mol, XLogP of -1.13, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dioxopyrimidin-1-yl) (2S)-2-amino-4-methylpentanoate is sourced from PubChem (CID 57302297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).