C4H6N4O2 — CID 57419744
1-hydrazinylpyrimidine-2,4-dione (PubChem CID 57419744) has the molecular formula C4H6N4O2 and a molecular weight of 142.12 g/mol. Its IUPAC name is 1-hydrazinylpyrimidine-2,4-dione.
| Compound Name | 1-hydrazinylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57419744 |
| Molecular Formula | C4H6N4O2 |
| Molecular Weight | 142.12 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | 1-hydrazinylpyrimidine-2,4-dione |
| SMILES | NNn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C4H6N4O2/c5-7-8-2-1-3(9)6-4(8)10/h1-2,7H,5H2,(H,6,9,10) |
| InChIKey | OWUZEONJEIWHQP-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.12 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|