C4H3IN2O2S — CID 23446998
(2,4-dioxopyrimidin-1-yl) thiohypoiodite (PubChem CID 23446998) has the molecular formula C4H3IN2O2S and a molecular weight of 270.05 g/mol. Its IUPAC name is (2,4-dioxopyrimidin-1-yl) thiohypoiodite.
| Compound Name | (2,4-dioxopyrimidin-1-yl) thiohypoiodite |
|---|---|
| PubChem CID | 23446998 |
| Molecular Formula | C4H3IN2O2S |
| Molecular Weight | 270.05 g/mol |
| Exact Mass | 269.90 |
| IUPAC Name | (2,4-dioxopyrimidin-1-yl) thiohypoiodite |
| SMILES | O=c1ccn(SI)c(=O)[nH]1 |
| InChI | InChI=1S/C4H3IN2O2S/c5-10-7-2-1-3(8)6-4(7)9/h1-2H,(H,6,8,9) |
| InChIKey | UZHLFQXRHZRYAP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.05 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|