About (2,4-dioxopyrimidin-1-yl) thiohypoiodite
(2,4-dioxopyrimidin-1-yl) thiohypoiodite (PubChem CID 23446998) has the molecular formula C4H3IN2O2S
and a molecular weight of 270.05 g/mol. Its IUPAC name is (2,4-dioxopyrimidin-1-yl) thiohypoiodite.
Molecular Properties
| Compound Name | (2,4-dioxopyrimidin-1-yl) thiohypoiodite |
| PubChem CID | 23446998 |
| Molecular Formula | C4H3IN2O2S |
| Molecular Weight | 270.05 g/mol |
| Exact Mass | 269.90 |
| IUPAC Name | (2,4-dioxopyrimidin-1-yl) thiohypoiodite |
| SMILES | O=c1ccn(SI)c(=O)[nH]1 |
| InChI | InChI=1S/C4H3IN2O2S/c5-10-7-2-1-3(8)6-4(7)9/h1-2H,(H,6,8,9) |
| InChIKey | UZHLFQXRHZRYAP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.05 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dioxopyrimidin-1-yl) thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dioxopyrimidin-1-yl) thiohypoiodite?
The IUPAC name of (2,4-dioxopyrimidin-1-yl) thiohypoiodite (CID 23446998) is (2,4-dioxopyrimidin-1-yl) thiohypoiodite.
What is the SMILES notation for (2,4-dioxopyrimidin-1-yl) thiohypoiodite?
The canonical SMILES for (2,4-dioxopyrimidin-1-yl) thiohypoiodite is O=c1ccn(SI)c(=O)[nH]1.
What is the InChIKey of (2,4-dioxopyrimidin-1-yl) thiohypoiodite?
The InChIKey is UZHLFQXRHZRYAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3IN2O2S/c5-10-7-2-1-3(8)6-4(7)9/h1-2H,(H,6,8,9).
What are the key properties of (2,4-dioxopyrimidin-1-yl) thiohypoiodite?
(2,4-dioxopyrimidin-1-yl) thiohypoiodite has a molecular weight of 270.05 g/mol, XLogP of 0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dioxopyrimidin-1-yl) thiohypoiodite is sourced from PubChem (CID 23446998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).