C12H11N3O2 — CID 170350288
1-(2,3-dihydro-1H-isoindol-5-yl)pyrimidine-2,4-dione (PubChem CID 170350288) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-isoindol-5-yl)pyrimidine-2,4-dione.
| Compound Name | 1-(2,3-dihydro-1H-isoindol-5-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170350288 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-(2,3-dihydro-1H-isoindol-5-yl)pyrimidine-2,4-dione |
| SMILES | O=c1ccn(-c2ccc3c(c2)CNC3)c(=O)[nH]1 |
| InChI | InChI=1S/C12H11N3O2/c16-11-3-4-15(12(17)14-11)10-2-1-8-6-13-7-9(8)5-10/h1-5,13H,6-7H2,(H,14,16,17) |
| InChIKey | BMKZZLBLBGHZGB-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |