C18H23N3O2 — CID 3237829
3-cyclohexyl-6-(3,4-dimethylanilino)-1H-pyrimidine-2,4-dione (PubChem CID 3237829) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-cyclohexyl-6-(3,4-dimethylanilino)-1H-pyrimidine-2,4-dione.
| Compound Name | 3-cyclohexyl-6-(3,4-dimethylanilino)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3237829 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 3-cyclohexyl-6-(3,4-dimethylanilino)-1H-pyrimidine-2,4-dione |
| SMILES | Cc1ccc(Nc2cc(=O)n(C3CCCCC3)c(=O)[nH]2)cc1C |
| InChI | InChI=1S/C18H23N3O2/c1-12-8-9-14(10-13(12)2)19-16-11-17(22)21(18(23)20-16)15-6-4-3-5-7-15/h8-11,15,19H,3-7H2,1-2H3,(H,20,23) |
| InChIKey | PRDQETVZSGJCKK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |