C9H8N4O2S — CID 142487376
1-(2-methylsulfanylpyrimidin-5-yl)pyrimidine-2,4-dione (PubChem CID 142487376) has the molecular formula C9H8N4O2S and a molecular weight of 236.26 g/mol. Its IUPAC name is 1-(2-methylsulfanylpyrimidin-5-yl)pyrimidine-2,4-dione.
| Compound Name | 1-(2-methylsulfanylpyrimidin-5-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142487376 |
| Molecular Formula | C9H8N4O2S |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 1-(2-methylsulfanylpyrimidin-5-yl)pyrimidine-2,4-dione |
| SMILES | CSc1ncc(-n2ccc(=O)[nH]c2=O)cn1 |
| InChI | InChI=1S/C9H8N4O2S/c1-16-8-10-4-6(5-11-8)13-3-2-7(14)12-9(13)15/h2-5H,1H3,(H,12,14,15) |
| InChIKey | SGEKGPXHFUAAOT-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |