C12H11N3O5S — CID 4089449
N-(4-methylphenyl)sulfonyl-2,4-dioxopyrimidine-1-carboxamide (PubChem CID 4089449) has the molecular formula C12H11N3O5S and a molecular weight of 309.30 g/mol. Its IUPAC name is N-(4-methylphenyl)sulfonyl-2,4-dioxopyrimidine-1-carboxamide.
| Compound Name | N-(4-methylphenyl)sulfonyl-2,4-dioxopyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 4089449 |
| Molecular Formula | C12H11N3O5S |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | N-(4-methylphenyl)sulfonyl-2,4-dioxopyrimidine-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)n2ccc(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C12H11N3O5S/c1-8-2-4-9(5-3-8)21(19,20)14-12(18)15-7-6-10(16)13-11(15)17/h2-7H,1H3,(H,14,18)(H,13,16,17) |
| InChIKey | BGOWPLZISHMCNQ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |