C15H20N4O4 — CID 90652303
N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide (PubChem CID 90652303) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide.
| Compound Name | N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 90652303 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide |
| SMILES | Cc1noc(C)c1CCCNC(=O)Cn1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H20N4O4/c1-9-7-19(15(22)17-14(9)21)8-13(20)16-6-4-5-12-10(2)18-23-11(12)3/h7H,4-6,8H2,1-3H3,(H,16,20)(H,17,21,22) |
| InChIKey | NMPXLGUOAQHXQV-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 109.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|