C25H30N2O4Si — CID 101263285
1-[2-[tert-butyl(diphenyl)silyl]oxyprop-2-enoxymethyl]-5-methylpyrimidine-2,4-dione (PubChem CID 101263285) has the molecular formula C25H30N2O4Si and a molecular weight of 450.61 g/mol. Its IUPAC name is 1-[2-[tert-butyl(diphenyl)silyl]oxyprop-2-enoxymethyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[2-[tert-butyl(diphenyl)silyl]oxyprop-2-enoxymethyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 101263285 |
| Molecular Formula | C25H30N2O4Si |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 1-[2-[tert-butyl(diphenyl)silyl]oxyprop-2-enoxymethyl]-5-methylpyrimidine-2,4-dione |
| SMILES | C=C(COCn1cc(C)c(=O)[nH]c1=O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H30N2O4Si/c1-19-16-27(24(29)26-23(19)28)18-30-17-20(2)31-32(25(3,4)5,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-16H,2,17-18H2,1,3-5H3,(H,26,28,29) |
| InChIKey | VYRLJPCKXIRYLD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|