C27H34N2O4Si — CID 70375402
1-[2-[2-[tert-butyl(diphenyl)silyl]oxyethoxymethyl]prop-2-enyl]-5-methylpyrimidine-2,4-dione (PubChem CID 70375402) has the molecular formula C27H34N2O4Si and a molecular weight of 478.67 g/mol. Its IUPAC name is 1-[2-[2-[tert-butyl(diphenyl)silyl]oxyethoxymethyl]prop-2-enyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[2-[2-[tert-butyl(diphenyl)silyl]oxyethoxymethyl]prop-2-enyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70375402 |
| Molecular Formula | C27H34N2O4Si |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 1-[2-[2-[tert-butyl(diphenyl)silyl]oxyethoxymethyl]prop-2-enyl]-5-methylpyrimidine-2,4-dione |
| SMILES | C=C(COCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)Cn1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C27H34N2O4Si/c1-21(18-29-19-22(2)25(30)28-26(29)31)20-32-16-17-33-34(27(3,4)5,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-15,19H,1,16-18,20H2,2-5H3,(H,28,30,31) |
| InChIKey | SWXSBFMKVDCEQP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|