C14H21N2O14P3 — CID 88616629
diphosphono hydrogen phosphate;1-[(2-hydroxy-1-phenylethoxy)methyl]-5-methylpyrimidine-2,4-dione (PubChem CID 88616629) has the molecular formula C14H21N2O14P3 and a molecular weight of 534.24 g/mol. Its IUPAC name is diphosphono hydrogen phosphate;1-[(2-hydroxy-1-phenylethoxy)methyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | diphosphono hydrogen phosphate;1-[(2-hydroxy-1-phenylethoxy)methyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 88616629 |
| Molecular Formula | C14H21N2O14P3 |
| Molecular Weight | 534.24 g/mol |
| Exact Mass | 534.02 |
| IUPAC Name | diphosphono hydrogen phosphate;1-[(2-hydroxy-1-phenylethoxy)methyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(COC(CO)c2ccccc2)c(=O)[nH]c1=O.O=P(O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C14H16N2O4.H5O10P3/c1-10-7-16(14(19)15-13(10)18)9-20-12(8-17)11-5-3-2-4-6-11;1-11(2,3)9-13(7,8)10-12(4,5)6/h2-7,12,17H,8-9H2,1H3,(H,15,18,19);(H,7,8)(H2,1,2,3)(H2,4,5,6) |
| InChIKey | JJEKUCOBHPFWAG-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 255.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.24 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|