C11H17FN2O4S — CID 88616565
1-[(4-fluoro-1-hydroxy-3-methyl-3-sulfanylbutan-2-yl)oxymethyl]-5-methylpyrimidine-2,4-dione (PubChem CID 88616565) has the molecular formula C11H17FN2O4S and a molecular weight of 292.33 g/mol. Its IUPAC name is 1-[(4-fluoro-1-hydroxy-3-methyl-3-sulfanylbutan-2-yl)oxymethyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(4-fluoro-1-hydroxy-3-methyl-3-sulfanylbutan-2-yl)oxymethyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 88616565 |
| Molecular Formula | C11H17FN2O4S |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1-[(4-fluoro-1-hydroxy-3-methyl-3-sulfanylbutan-2-yl)oxymethyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(COC(CO)C(C)(S)CF)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H17FN2O4S/c1-7-3-14(10(17)13-9(7)16)6-18-8(4-15)11(2,19)5-12/h3,8,15,19H,4-6H2,1-2H3,(H,13,16,17) |
| InChIKey | NDHPOOSQIHBFCC-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|