C15H28N2O4Si — CID 173352961
1-[(1-dimethylsilyloxy-4,4-dimethylpentoxy)methyl]-5-methylpyrimidine-2,4-dione (PubChem CID 173352961) has the molecular formula C15H28N2O4Si and a molecular weight of 328.49 g/mol. Its IUPAC name is 1-[(1-dimethylsilyloxy-4,4-dimethylpentoxy)methyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(1-dimethylsilyloxy-4,4-dimethylpentoxy)methyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 173352961 |
| Molecular Formula | C15H28N2O4Si |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 1-[(1-dimethylsilyloxy-4,4-dimethylpentoxy)methyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(COC(CCC(C)(C)C)O[SiH](C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H28N2O4Si/c1-11-9-17(14(19)16-13(11)18)10-20-12(21-22(5)6)7-8-15(2,3)4/h9,12,22H,7-8,10H2,1-6H3,(H,16,18,19) |
| InChIKey | FTJHGLPHMFNNGF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|