C39H42FN3O11SSi — CID 71500262
[(2R,3R,4R,5S)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-1,3,4-tris(phenylmethoxy)-5-trimethylsilyloxypentan-2-yl] 4-nitrobenzenesulfonate (PubChem CID 71500262) has the molecular formula C39H42FN3O11SSi and a molecular weight of 807.93 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-1,3,4-tris(phenylmethoxy)-5-trimethylsilyloxypentan-2-yl] 4-nitrobenzenesulfonate.
| Compound Name | [(2R,3R,4R,5S)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-1,3,4-tris(phenylmethoxy)-5-trimethylsilyloxypentan-2-yl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 71500262 |
| Molecular Formula | C39H42FN3O11SSi |
| Molecular Weight | 807.93 g/mol |
| Exact Mass | 807.23 |
| IUPAC Name | [(2R,3R,4R,5S)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-1,3,4-tris(phenylmethoxy)-5-trimethylsilyloxypentan-2-yl] 4-nitrobenzenesulfonate |
| SMILES | C[Si](C)(C)O[C@@H]([C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OS(=O)(=O)c1ccc([N+](=O)[O-])cc1)n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C39H42FN3O11SSi/c1-56(2,3)54-38(42-23-33(40)37(44)41-39(42)45)36(52-26-30-17-11-6-12-18-30)35(51-25-29-15-9-5-10-16-29)34(27-50-24-28-13-7-4-8-14-28)53-55(48,49)32-21-19-31(20-22-32)43(46)47/h4-23,34-36,38H,24-27H2,1-3H3,(H,41,44,45)/t34-,35+,36-,38+/m1/s1 |
| InChIKey | VTKFFUQNDTYNOB-MIDIUVBKSA-N |
| XLogP | 6.10 |
| TPSA | 178.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.93 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|