C27H29NO6S — CID 23729630
[(1R)-1-[(2S,3S)-3-(dimethylcarbamoyl)oxiran-2-yl]-2-trityloxyethyl] methanesulfonate (PubChem CID 23729630) has the molecular formula C27H29NO6S and a molecular weight of 495.60 g/mol. Its IUPAC name is [(1R)-1-[(2S,3S)-3-(dimethylcarbamoyl)oxiran-2-yl]-2-trityloxyethyl] methanesulfonate.
| Compound Name | [(1R)-1-[(2S,3S)-3-(dimethylcarbamoyl)oxiran-2-yl]-2-trityloxyethyl] methanesulfonate |
|---|---|
| PubChem CID | 23729630 |
| Molecular Formula | C27H29NO6S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | [(1R)-1-[(2S,3S)-3-(dimethylcarbamoyl)oxiran-2-yl]-2-trityloxyethyl] methanesulfonate |
| SMILES | CN(C)C(=O)[C@H]1O[C@@H]1[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)OS(C)(=O)=O |
| InChI | InChI=1S/C27H29NO6S/c1-28(2)26(29)25-24(33-25)23(34-35(3,30)31)19-32-27(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18,23-25H,19H2,1-3H3/t23-,24-,25+/m1/s1 |
| InChIKey | YVXCHOMLVHBZKF-SDHSZQHLSA-N |
| XLogP | 3.20 |
| TPSA | 85.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|