C28H32O5 — CID 135009925
(1R)-1-[(4R,5S)-5-(hydroxymethyl)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanol (PubChem CID 135009925) has the molecular formula C28H32O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is (1R)-1-[(4R,5S)-5-(hydroxymethyl)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanol.
| Compound Name | (1R)-1-[(4R,5S)-5-(hydroxymethyl)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanol |
|---|---|
| PubChem CID | 135009925 |
| Molecular Formula | C28H32O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | (1R)-1-[(4R,5S)-5-(hydroxymethyl)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanol |
| SMILES | CC1(C)O[C@H]([C@H](O)COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@](C)(CO)O1 |
| InChI | InChI=1S/C28H32O5/c1-26(2)32-25(27(3,20-29)33-26)24(30)19-31-28(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-18,24-25,29-30H,19-20H2,1-3H3/t24-,25-,27+/m1/s1 |
| InChIKey | WIYFWUWEAHLSNT-SLQPCKNISA-N |
| XLogP | 4.26 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|