C32H30Cl2N2O4 — CID 134931381
(1R)-1-[(4R,5S)-5-[(Z)-2-chloro-2-(6-chloropyrimidin-4-yl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanol (PubChem CID 134931381) has the molecular formula C32H30Cl2N2O4 and a molecular weight of 577.51 g/mol. Its IUPAC name is (1R)-1-[(4R,5S)-5-[(Z)-2-chloro-2-(6-chloropyrimidin-4-yl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanol.
| Compound Name | (1R)-1-[(4R,5S)-5-[(Z)-2-chloro-2-(6-chloropyrimidin-4-yl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanol |
|---|---|
| PubChem CID | 134931381 |
| Molecular Formula | C32H30Cl2N2O4 |
| Molecular Weight | 577.51 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | (1R)-1-[(4R,5S)-5-[(Z)-2-chloro-2-(6-chloropyrimidin-4-yl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanol |
| SMILES | CC1(C)O[C@H]([C@H](O)COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H](/C=C(\Cl)c2cc(Cl)ncn2)O1 |
| InChI | InChI=1S/C32H30Cl2N2O4/c1-31(2)39-28(18-25(33)26-19-29(34)36-21-35-26)30(40-31)27(37)20-38-32(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-19,21,27-28,30,37H,20H2,1-2H3/b25-18-/t27-,28+,30-/m1/s1 |
| InChIKey | NDUVEJFLMZKZON-VIQMABCASA-N |
| XLogP | 6.60 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.51 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|