C21H31Cl2NO6Si — CID 10973034
(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-5-[(E)-2-(4,5-dichloro-2-nitrophenyl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol (PubChem CID 10973034) has the molecular formula C21H31Cl2NO6Si and a molecular weight of 492.47 g/mol. Its IUPAC name is (1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-5-[(E)-2-(4,5-dichloro-2-nitrophenyl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol.
| Compound Name | (1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-5-[(E)-2-(4,5-dichloro-2-nitrophenyl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 10973034 |
| Molecular Formula | C21H31Cl2NO6Si |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | (1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-5-[(E)-2-(4,5-dichloro-2-nitrophenyl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
| SMILES | CC1(C)O[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](/C=C/c2cc(Cl)c(Cl)cc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C21H31Cl2NO6Si/c1-20(2,3)31(6,7)28-12-17(25)19-18(29-21(4,5)30-19)9-8-13-10-14(22)15(23)11-16(13)24(26)27/h8-11,17-19,25H,12H2,1-7H3/b9-8+/t17-,18+,19-/m1/s1 |
| InChIKey | RNLFCQHIVJWYHY-UMPVYUTHSA-N |
| XLogP | 5.82 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|