C25H41NO4Si — CID 71613137
(1R)-1-[(4R,5S)-5-[(2S)-1-benzyl-3,6-dihydro-2H-pyridin-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol (PubChem CID 71613137) has the molecular formula C25H41NO4Si and a molecular weight of 447.69 g/mol. Its IUPAC name is (1R)-1-[(4R,5S)-5-[(2S)-1-benzyl-3,6-dihydro-2H-pyridin-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol.
| Compound Name | (1R)-1-[(4R,5S)-5-[(2S)-1-benzyl-3,6-dihydro-2H-pyridin-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol |
|---|---|
| PubChem CID | 71613137 |
| Molecular Formula | C25H41NO4Si |
| Molecular Weight | 447.69 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | (1R)-1-[(4R,5S)-5-[(2S)-1-benzyl-3,6-dihydro-2H-pyridin-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol |
| SMILES | CC1(C)O[C@@H]([C@@H]2CC=CCN2Cc2ccccc2)[C@@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C25H41NO4Si/c1-24(2,3)31(6,7)28-18-21(27)23-22(29-25(4,5)30-23)20-15-11-12-16-26(20)17-19-13-9-8-10-14-19/h8-14,20-23,27H,15-18H2,1-7H3/t20-,21+,22-,23+/m0/s1 |
| InChIKey | NUFMSGVFLWNAPJ-GSPCLOLRSA-N |
| XLogP | 4.72 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|