C23H45NO4Si — CID 101401016
(1R)-1-[(3aR,6S,6aS)-2,2-dimethyl-4-octyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-6-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol (PubChem CID 101401016) has the molecular formula C23H45NO4Si and a molecular weight of 427.70 g/mol. Its IUPAC name is (1R)-1-[(3aR,6S,6aS)-2,2-dimethyl-4-octyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-6-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol.
| Compound Name | (1R)-1-[(3aR,6S,6aS)-2,2-dimethyl-4-octyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-6-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol |
|---|---|
| PubChem CID | 101401016 |
| Molecular Formula | C23H45NO4Si |
| Molecular Weight | 427.70 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | (1R)-1-[(3aR,6S,6aS)-2,2-dimethyl-4-octyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-6-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol |
| SMILES | CCCCCCCCC1=N[C@@H]([C@@H](O)CO[Si](C)(C)C(C)(C)C)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C23H45NO4Si/c1-9-10-11-12-13-14-15-17-20-21(28-23(5,6)27-20)19(24-17)18(25)16-26-29(7,8)22(2,3)4/h18-21,25H,9-16H2,1-8H3/t18-,19-,20+,21-/m0/s1 |
| InChIKey | IDPGLRQCEGZYOB-BURNTYAHSA-N |
| XLogP | 5.46 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.70 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|