C24H42O6Si — CID 10072688
3-[(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-octanoyl-2H-furan-5-one (PubChem CID 10072688) has the molecular formula C24H42O6Si and a molecular weight of 454.68 g/mol. Its IUPAC name is 3-[(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-octanoyl-2H-furan-5-one.
| Compound Name | 3-[(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-octanoyl-2H-furan-5-one |
|---|---|
| PubChem CID | 10072688 |
| Molecular Formula | C24H42O6Si |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | 3-[(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-octanoyl-2H-furan-5-one |
| SMILES | CCCCCCCC(=O)C1=C([C@H]2OC(C)(C)O[C@@H]2CO[Si](C)(C)C(C)(C)C)COC1=O |
| InChI | InChI=1S/C24H42O6Si/c1-9-10-11-12-13-14-18(25)20-17(15-27-22(20)26)21-19(29-24(5,6)30-21)16-28-31(7,8)23(2,3)4/h19,21H,9-16H2,1-8H3/t19-,21-/m1/s1 |
| InChIKey | KIBSTEOTYGLDHB-TZIWHRDSSA-N |
| XLogP | 5.31 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|