C23H42O8Si — CID 11038087
3-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-bis(methoxymethoxy)propyl]-4-hexanoyl-2H-furan-5-one (PubChem CID 11038087) has the molecular formula C23H42O8Si and a molecular weight of 474.67 g/mol. Its IUPAC name is 3-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-bis(methoxymethoxy)propyl]-4-hexanoyl-2H-furan-5-one.
| Compound Name | 3-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-bis(methoxymethoxy)propyl]-4-hexanoyl-2H-furan-5-one |
|---|---|
| PubChem CID | 11038087 |
| Molecular Formula | C23H42O8Si |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 3-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-bis(methoxymethoxy)propyl]-4-hexanoyl-2H-furan-5-one |
| SMILES | CCCCCC(=O)C1=C([C@@H](OCOC)[C@@H](CO[Si](C)(C)C(C)(C)C)OCOC)COC1=O |
| InChI | InChI=1S/C23H42O8Si/c1-9-10-11-12-18(24)20-17(13-28-22(20)25)21(30-16-27-6)19(29-15-26-5)14-31-32(7,8)23(2,3)4/h19,21H,9-16H2,1-8H3/t19-,21-/m1/s1 |
| InChIKey | UHTGREDVJCEZRF-TZIWHRDSSA-N |
| XLogP | 3.99 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|