C23H44O9Si — CID 11103032
[(3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3,4-bis(methoxymethoxy)-2-oxopentyl] 3-oxooctanoate (PubChem CID 11103032) has the molecular formula C23H44O9Si and a molecular weight of 492.68 g/mol. Its IUPAC name is [(3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3,4-bis(methoxymethoxy)-2-oxopentyl] 3-oxooctanoate.
| Compound Name | [(3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3,4-bis(methoxymethoxy)-2-oxopentyl] 3-oxooctanoate |
|---|---|
| PubChem CID | 11103032 |
| Molecular Formula | C23H44O9Si |
| Molecular Weight | 492.68 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | [(3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3,4-bis(methoxymethoxy)-2-oxopentyl] 3-oxooctanoate |
| SMILES | CCCCCC(=O)CC(=O)OCC(=O)[C@@H](OCOC)[C@@H](CO[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C23H44O9Si/c1-9-10-11-12-18(24)13-21(26)29-14-19(25)22(31-17-28-6)20(30-16-27-5)15-32-33(7,8)23(2,3)4/h20,22H,9-17H2,1-8H3/t20-,22-/m1/s1 |
| InChIKey | OGAOFPJBJALUBD-IFMALSPDSA-N |
| XLogP | 3.64 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.68 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|