C16H29FO4Si — CID 71614460
[(3aR,4Z,6R,6aR)-4-(1-fluoroethylidene)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 71614460) has the molecular formula C16H29FO4Si and a molecular weight of 332.49 g/mol. Its IUPAC name is [(3aR,4Z,6R,6aR)-4-(1-fluoroethylidene)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4Z,6R,6aR)-4-(1-fluoroethylidene)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 71614460 |
| Molecular Formula | C16H29FO4Si |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | [(3aR,4Z,6R,6aR)-4-(1-fluoroethylidene)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C/C(F)=C1/O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C16H29FO4Si/c1-10(17)12-14-13(20-16(5,6)21-14)11(19-12)9-18-22(7,8)15(2,3)4/h11,13-14H,9H2,1-8H3/b12-10-/t11-,13-,14+/m1/s1 |
| InChIKey | LOXTUGOXMITCLM-ITJLTHJNSA-N |
| XLogP | 4.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|