C21H39NO7SSi — CID 10600704
(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-5-[(S)-[2-(1,1-dimethoxyethyl)-1,3-thiazol-5-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol (PubChem CID 10600704) has the molecular formula C21H39NO7SSi and a molecular weight of 477.70 g/mol. Its IUPAC name is (1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-5-[(S)-[2-(1,1-dimethoxyethyl)-1,3-thiazol-5-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol.
| Compound Name | (1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-5-[(S)-[2-(1,1-dimethoxyethyl)-1,3-thiazol-5-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 10600704 |
| Molecular Formula | C21H39NO7SSi |
| Molecular Weight | 477.70 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | (1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-5-[(S)-[2-(1,1-dimethoxyethyl)-1,3-thiazol-5-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
| SMILES | COC(C)(OC)c1ncc([C@@H](O)[C@@H]2OC(C)(C)O[C@@H]2[C@H](O)CO[Si](C)(C)C(C)(C)C)s1 |
| InChI | InChI=1S/C21H39NO7SSi/c1-19(2,3)31(9,10)27-12-13(23)16-17(29-20(4,5)28-16)15(24)14-11-22-18(30-14)21(6,25-7)26-8/h11,13,15-17,23-24H,12H2,1-10H3/t13-,15-,16-,17+/m1/s1 |
| InChIKey | VAXYWVHVDYSIMO-DZUCGIPZSA-N |
| XLogP | 3.54 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.70 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|