C22H36N2O6SSi — CID 101265363
ethyl (Z)-3-[(4S,5S)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(imidazole-1-carbothioyloxy)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 101265363) has the molecular formula C22H36N2O6SSi and a molecular weight of 484.69 g/mol. Its IUPAC name is ethyl (Z)-3-[(4S,5S)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(imidazole-1-carbothioyloxy)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[(4S,5S)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(imidazole-1-carbothioyloxy)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 101265363 |
| Molecular Formula | C22H36N2O6SSi |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | ethyl (Z)-3-[(4S,5S)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(imidazole-1-carbothioyloxy)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C\[C@@H]1OC(C)(C)O[C@@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)OC(=S)n1ccnc1 |
| InChI | InChI=1S/C22H36N2O6SSi/c1-9-26-18(25)11-10-16-19(30-22(5,6)29-16)17(14-27-32(7,8)21(2,3)4)28-20(31)24-13-12-23-15-24/h10-13,15-17,19H,9,14H2,1-8H3/b11-10-/t16-,17+,19-/m0/s1 |
| InChIKey | BHTYPOWVQULPJL-BOPIPBMHSA-N |
| XLogP | 4.06 |
| TPSA | 81.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|