C33H40O6 — CID 163053012
methyl (2R,3S,4S)-3-hydroxy-2-methyl-4-[(4R,5R)-2,2,5-trimethyl-5-(trityloxymethyl)-1,3-dioxolan-4-yl]pentanoate (PubChem CID 163053012) has the molecular formula C33H40O6 and a molecular weight of 532.68 g/mol. Its IUPAC name is methyl (2R,3S,4S)-3-hydroxy-2-methyl-4-[(4R,5R)-2,2,5-trimethyl-5-(trityloxymethyl)-1,3-dioxolan-4-yl]pentanoate.
| Compound Name | methyl (2R,3S,4S)-3-hydroxy-2-methyl-4-[(4R,5R)-2,2,5-trimethyl-5-(trityloxymethyl)-1,3-dioxolan-4-yl]pentanoate |
|---|---|
| PubChem CID | 163053012 |
| Molecular Formula | C33H40O6 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | methyl (2R,3S,4S)-3-hydroxy-2-methyl-4-[(4R,5R)-2,2,5-trimethyl-5-(trityloxymethyl)-1,3-dioxolan-4-yl]pentanoate |
| SMILES | COC(=O)[C@H](C)[C@@H](O)[C@H](C)[C@H]1OC(C)(C)O[C@]1(C)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H40O6/c1-23(28(34)24(2)30(35)36-6)29-32(5,39-31(3,4)38-29)22-37-33(25-16-10-7-11-17-25,26-18-12-8-13-19-26)27-20-14-9-15-21-27/h7-21,23-24,28-29,34H,22H2,1-6H3/t23-,24+,28-,29+,32+/m0/s1 |
| InChIKey | MNVDCQLPXCNBEC-MXQFHEBNSA-N |
| XLogP | 5.71 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|