C37H46O4 — CID 101234906
(4S,5R)-2,2-dimethyl-5-(trityloxymethyl)-5-[(E)-undec-1-enyl]-1,3-dioxolane-4-carbaldehyde (PubChem CID 101234906) has the molecular formula C37H46O4 and a molecular weight of 554.77 g/mol. Its IUPAC name is (4S,5R)-2,2-dimethyl-5-(trityloxymethyl)-5-[(E)-undec-1-enyl]-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4S,5R)-2,2-dimethyl-5-(trityloxymethyl)-5-[(E)-undec-1-enyl]-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 101234906 |
| Molecular Formula | C37H46O4 |
| Molecular Weight | 554.77 g/mol |
| Exact Mass | 554.34 |
| IUPAC Name | (4S,5R)-2,2-dimethyl-5-(trityloxymethyl)-5-[(E)-undec-1-enyl]-1,3-dioxolane-4-carbaldehyde |
| SMILES | CCCCCCCCC/C=C/[C@]1(COC(c2ccccc2)(c2ccccc2)c2ccccc2)OC(C)(C)O[C@@H]1C=O |
| InChI | InChI=1S/C37H46O4/c1-4-5-6-7-8-9-10-11-21-28-36(34(29-38)40-35(2,3)41-36)30-39-37(31-22-15-12-16-23-31,32-24-17-13-18-25-32)33-26-19-14-20-27-33/h12-29,34H,4-11,30H2,1-3H3/b28-21+/t34-,36-/m1/s1 |
| InChIKey | XNMKPQSQNPWVLL-KDCDKVDHSA-N |
| XLogP | 8.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.77 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|