C34H36O8 — CID 134917648
diethyl 2-[(3aR,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]propanedioate (PubChem CID 134917648) has the molecular formula C34H36O8 and a molecular weight of 572.65 g/mol. Its IUPAC name is diethyl 2-[(3aR,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]propanedioate.
| Compound Name | diethyl 2-[(3aR,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]propanedioate |
|---|---|
| PubChem CID | 134917648 |
| Molecular Formula | C34H36O8 |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | diethyl 2-[(3aR,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)=C1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C34H36O8/c1-5-37-31(35)27(32(36)38-6-2)29-30-28(41-33(3,4)42-30)26(40-29)22-39-34(23-16-10-7-11-17-23,24-18-12-8-13-19-24)25-20-14-9-15-21-25/h7-21,26,28,30H,5-6,22H2,1-4H3/t26-,28-,30-/m1/s1 |
| InChIKey | YXTXDCAGYNPVGF-YQKLYGQBSA-N |
| XLogP | 5.29 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|