C32H34O5 — CID 135078176
ethyl 2-[(3aR,6R,6aS)-2,2-dimethyl-4-(trityloxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]acetate (PubChem CID 135078176) has the molecular formula C32H34O5 and a molecular weight of 498.62 g/mol. Its IUPAC name is ethyl 2-[(3aR,6R,6aS)-2,2-dimethyl-4-(trityloxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]acetate.
| Compound Name | ethyl 2-[(3aR,6R,6aS)-2,2-dimethyl-4-(trityloxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]acetate |
|---|---|
| PubChem CID | 135078176 |
| Molecular Formula | C32H34O5 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | ethyl 2-[(3aR,6R,6aS)-2,2-dimethyl-4-(trityloxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1C=C(COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C32H34O5/c1-4-34-28(33)21-23-20-24(30-29(23)36-31(2,3)37-30)22-35-32(25-14-8-5-9-15-25,26-16-10-6-11-17-26)27-18-12-7-13-19-27/h5-20,23,29-30H,4,21-22H2,1-3H3/t23-,29-,30+/m0/s1 |
| InChIKey | ZGPLWRUUBBQXPP-KEPSJGTLSA-N |
| XLogP | 6.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|