C31H30N4O4 — CID 68999855
1-[2,2-dimethyl-4-(trityloxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]triazole-4-carboxamide (PubChem CID 68999855) has the molecular formula C31H30N4O4 and a molecular weight of 522.61 g/mol. Its IUPAC name is 1-[2,2-dimethyl-4-(trityloxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]triazole-4-carboxamide.
| Compound Name | 1-[2,2-dimethyl-4-(trityloxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 68999855 |
| Molecular Formula | C31H30N4O4 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 1-[2,2-dimethyl-4-(trityloxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]triazole-4-carboxamide |
| SMILES | CC1(C)OC2C(COC(c3ccccc3)(c3ccccc3)c3ccccc3)=CC(n3cc(C(N)=O)nn3)C2O1 |
| InChI | InChI=1S/C31H30N4O4/c1-30(2)38-27-21(18-26(28(27)39-30)35-19-25(29(32)36)33-34-35)20-37-31(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-19,26-28H,20H2,1-2H3,(H2,32,36) |
| InChIKey | VPHZLQZDEXVTFG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|