C56H95NO3Si2 — CID 171814705
2-[tert-butyl(dimethyl)silyl]oxy-N-[2-[tert-butyl(dimethyl)silyl]oxydecyl]-N-(5-trityloxypentyl)decan-1-amine (PubChem CID 171814705) has the molecular formula C56H95NO3Si2 and a molecular weight of 886.55 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-N-[2-[tert-butyl(dimethyl)silyl]oxydecyl]-N-(5-trityloxypentyl)decan-1-amine.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-N-[2-[tert-butyl(dimethyl)silyl]oxydecyl]-N-(5-trityloxypentyl)decan-1-amine |
|---|---|
| PubChem CID | 171814705 |
| Molecular Formula | C56H95NO3Si2 |
| Molecular Weight | 886.55 g/mol |
| Exact Mass | 885.69 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-N-[2-[tert-butyl(dimethyl)silyl]oxydecyl]-N-(5-trityloxypentyl)decan-1-amine |
| SMILES | CCCCCCCCC(CN(CCCCCOC(c1ccccc1)(c1ccccc1)c1ccccc1)CC(CCCCCCCC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C56H95NO3Si2/c1-13-15-17-19-21-33-43-52(59-61(9,10)54(3,4)5)47-57(48-53(44-34-22-20-18-16-14-2)60-62(11,12)55(6,7)8)45-35-26-36-46-58-56(49-37-27-23-28-38-49,50-39-29-24-30-40-50)51-41-31-25-32-42-51/h23-25,27-32,37-42,52-53H,13-22,26,33-36,43-48H2,1-12H3 |
| InChIKey | CBBCTKNARPVFHF-UHFFFAOYSA-N |
| XLogP | 16.75 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.55 |
| LogP ≤ 5 | 16.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|