C56H102N2O5Si2 — CID 178066817
(2S)-2-[3-[bis[(2S)-2-[tert-butyl(dimethyl)silyl]oxydodecyl]amino]propylamino]-4-(4-phenylmethoxyphenyl)butanoic acid (PubChem CID 178066817) has the molecular formula C56H102N2O5Si2 and a molecular weight of 939.61 g/mol. Its IUPAC name is (2S)-2-[3-[bis[(2S)-2-[tert-butyl(dimethyl)silyl]oxydodecyl]amino]propylamino]-4-(4-phenylmethoxyphenyl)butanoic acid.
| Compound Name | (2S)-2-[3-[bis[(2S)-2-[tert-butyl(dimethyl)silyl]oxydodecyl]amino]propylamino]-4-(4-phenylmethoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 178066817 |
| Molecular Formula | C56H102N2O5Si2 |
| Molecular Weight | 939.61 g/mol |
| Exact Mass | 938.73 |
| IUPAC Name | (2S)-2-[3-[bis[(2S)-2-[tert-butyl(dimethyl)silyl]oxydodecyl]amino]propylamino]-4-(4-phenylmethoxyphenyl)butanoic acid |
| SMILES | CCCCCCCCCC[C@@H](CN(CCCN[C@@H](CCc1ccc(OCc2ccccc2)cc1)C(=O)O)C[C@H](CCCCCCCCCC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C56H102N2O5Si2/c1-13-15-17-19-21-23-25-30-35-51(62-64(9,10)55(3,4)5)45-58(46-52(63-65(11,12)56(6,7)8)36-31-26-24-22-20-18-16-14-2)44-32-43-57-53(54(59)60)42-39-48-37-40-50(41-38-48)61-47-49-33-28-27-29-34-49/h27-29,33-34,37-38,40-41,51-53,57H,13-26,30-32,35-36,39,42-47H2,1-12H3,(H,59,60)/t51-,52-,53-/m0/s1 |
| InChIKey | KQDUFIWPURTPJC-QTACXXFESA-N |
| XLogP | 15.78 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.61 |
| LogP ≤ 5 | 15.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|